C17H29Cl2N3O2 — CID 120646440
(5-amino-2-methylphenyl)-[3-ethyl-4-(2-methoxyethyl)piperazin-1-yl]methanone;dihydrochloride (PubChem CID 120646440) has the molecular formula C17H29Cl2N3O2 and a molecular weight of 378.34 g/mol. Its IUPAC name is (5-amino-2-methylphenyl)-[3-ethyl-4-(2-methoxyethyl)piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | (5-amino-2-methylphenyl)-[3-ethyl-4-(2-methoxyethyl)piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 120646440 |
| Molecular Formula | C17H29Cl2N3O2 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (5-amino-2-methylphenyl)-[3-ethyl-4-(2-methoxyethyl)piperazin-1-yl]methanone;dihydrochloride |
| SMILES | CCC1CN(C(=O)c2cc(N)ccc2C)CCN1CCOC.Cl.Cl |
| InChI | InChI=1S/C17H27N3O2.2ClH/c1-4-15-12-20(8-7-19(15)9-10-22-3)17(21)16-11-14(18)6-5-13(16)2;;/h5-6,11,15H,4,7-10,12,18H2,1-3H3;2*1H |
| InChIKey | WXUHXJRNZGYWSO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|