C15H24N2O5S — CID 86966440
[3-ethyl-4-(2-methoxyethyl)piperazin-1-yl]-(5-methylsulfonylfuran-2-yl)methanone (PubChem CID 86966440) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is [3-ethyl-4-(2-methoxyethyl)piperazin-1-yl]-(5-methylsulfonylfuran-2-yl)methanone.
| Compound Name | [3-ethyl-4-(2-methoxyethyl)piperazin-1-yl]-(5-methylsulfonylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 86966440 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [3-ethyl-4-(2-methoxyethyl)piperazin-1-yl]-(5-methylsulfonylfuran-2-yl)methanone |
| SMILES | CCC1CN(C(=O)c2ccc(S(C)(=O)=O)o2)CCN1CCOC |
| InChI | InChI=1S/C15H24N2O5S/c1-4-12-11-17(8-7-16(12)9-10-21-2)15(18)13-5-6-14(22-13)23(3,19)20/h5-6,12H,4,7-11H2,1-3H3 |
| InChIKey | GIVJETGYVWYWSY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |