C17H28N4O2 — CID 119880994
3-piperidin-3-yl-1-[2-(pyrazol-1-ylmethyl)morpholin-4-yl]butan-1-one (PubChem CID 119880994) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-piperidin-3-yl-1-[2-(pyrazol-1-ylmethyl)morpholin-4-yl]butan-1-one.
| Compound Name | 3-piperidin-3-yl-1-[2-(pyrazol-1-ylmethyl)morpholin-4-yl]butan-1-one |
|---|---|
| PubChem CID | 119880994 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 3-piperidin-3-yl-1-[2-(pyrazol-1-ylmethyl)morpholin-4-yl]butan-1-one |
| SMILES | CC(CC(=O)N1CCOC(Cn2cccn2)C1)C1CCCNC1 |
| InChI | InChI=1S/C17H28N4O2/c1-14(15-4-2-5-18-11-15)10-17(22)20-8-9-23-16(12-20)13-21-7-3-6-19-21/h3,6-7,14-16,18H,2,4-5,8-13H2,1H3 |
| InChIKey | OMQFZTZRSWDWDC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |