C13H22Cl2N4O2 — CID 119881027
[2-(pyrazol-1-ylmethyl)morpholin-4-yl]-pyrrolidin-3-ylmethanone;dihydrochloride (PubChem CID 119881027) has the molecular formula C13H22Cl2N4O2 and a molecular weight of 337.25 g/mol. Its IUPAC name is [2-(pyrazol-1-ylmethyl)morpholin-4-yl]-pyrrolidin-3-ylmethanone;dihydrochloride.
| Compound Name | [2-(pyrazol-1-ylmethyl)morpholin-4-yl]-pyrrolidin-3-ylmethanone;dihydrochloride |
|---|---|
| PubChem CID | 119881027 |
| Molecular Formula | C13H22Cl2N4O2 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [2-(pyrazol-1-ylmethyl)morpholin-4-yl]-pyrrolidin-3-ylmethanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(C1CCNC1)N1CCOC(Cn2cccn2)C1 |
| InChI | InChI=1S/C13H20N4O2.2ClH/c18-13(11-2-4-14-8-11)16-6-7-19-12(9-16)10-17-5-1-3-15-17;;/h1,3,5,11-12,14H,2,4,6-10H2;2*1H |
| InChIKey | LTENOJJEOZRTLD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |