C15H20Cl2N4O2 — CID 119881009
(3-aminophenyl)-[2-(pyrazol-1-ylmethyl)morpholin-4-yl]methanone;dihydrochloride (PubChem CID 119881009) has the molecular formula C15H20Cl2N4O2 and a molecular weight of 359.26 g/mol. Its IUPAC name is (3-aminophenyl)-[2-(pyrazol-1-ylmethyl)morpholin-4-yl]methanone;dihydrochloride.
| Compound Name | (3-aminophenyl)-[2-(pyrazol-1-ylmethyl)morpholin-4-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119881009 |
| Molecular Formula | C15H20Cl2N4O2 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (3-aminophenyl)-[2-(pyrazol-1-ylmethyl)morpholin-4-yl]methanone;dihydrochloride |
| SMILES | Cl.Cl.Nc1cccc(C(=O)N2CCOC(Cn3cccn3)C2)c1 |
| InChI | InChI=1S/C15H18N4O2.2ClH/c16-13-4-1-3-12(9-13)15(20)18-7-8-21-14(10-18)11-19-6-2-5-17-19;;/h1-6,9,14H,7-8,10-11,16H2;2*1H |
| InChIKey | RJEXSGFRKPOIIX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|