C12H20N4O2 — CID 119881008
(2S)-2-amino-1-[2-(pyrazol-1-ylmethyl)morpholin-4-yl]butan-1-one (PubChem CID 119881008) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is (2S)-2-amino-1-[2-(pyrazol-1-ylmethyl)morpholin-4-yl]butan-1-one.
| Compound Name | (2S)-2-amino-1-[2-(pyrazol-1-ylmethyl)morpholin-4-yl]butan-1-one |
|---|---|
| PubChem CID | 119881008 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (2S)-2-amino-1-[2-(pyrazol-1-ylmethyl)morpholin-4-yl]butan-1-one |
| SMILES | CC[C@H](N)C(=O)N1CCOC(Cn2cccn2)C1 |
| InChI | InChI=1S/C12H20N4O2/c1-2-11(13)12(17)15-6-7-18-10(8-15)9-16-5-3-4-14-16/h3-5,10-11H,2,6-9,13H2,1H3/t10?,11-/m0/s1 |
| InChIKey | MDELUDUAVGMIOB-DTIOYNMSSA-N |
| XLogP | -0.15 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |