C18H29Cl2F2N3O2 — CID 119882877
7-amino-N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]heptanamide;dihydrochloride (PubChem CID 119882877) has the molecular formula C18H29Cl2F2N3O2 and a molecular weight of 428.35 g/mol. Its IUPAC name is 7-amino-N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]heptanamide;dihydrochloride.
| Compound Name | 7-amino-N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]heptanamide;dihydrochloride |
|---|---|
| PubChem CID | 119882877 |
| Molecular Formula | C18H29Cl2F2N3O2 |
| Molecular Weight | 428.35 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 7-amino-N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]heptanamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCCCCC(=O)NC1CCN(c2ccccc2OC(F)F)C1 |
| InChI | InChI=1S/C18H27F2N3O2.2ClH/c19-18(20)25-16-8-5-4-7-15(16)23-12-10-14(13-23)22-17(24)9-3-1-2-6-11-21;;/h4-5,7-8,14,18H,1-3,6,9-13,21H2,(H,22,24);2*1H |
| InChIKey | MALNUISXQIODEL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|