C23H27F2N3O2 — CID 86963270
N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-phenyl-2-pyrrolidin-1-ylacetamide (PubChem CID 86963270) has the molecular formula C23H27F2N3O2 and a molecular weight of 415.48 g/mol. Its IUPAC name is N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-phenyl-2-pyrrolidin-1-ylacetamide.
| Compound Name | N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-phenyl-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 86963270 |
| Molecular Formula | C23H27F2N3O2 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | N-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-phenyl-2-pyrrolidin-1-ylacetamide |
| SMILES | O=C(NC1CCN(c2ccccc2OC(F)F)C1)C(c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C23H27F2N3O2/c24-23(25)30-20-11-5-4-10-19(20)28-15-12-18(16-28)26-22(29)21(27-13-6-7-14-27)17-8-2-1-3-9-17/h1-5,8-11,18,21,23H,6-7,12-16H2,(H,26,29) |
| InChIKey | KQRFWYCGUXLMES-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |