C20H39N3O — CID 119884460
N-[2-(3-ethylpiperidin-1-yl)-2-methylpropyl]-3-piperidin-3-ylbutanamide (PubChem CID 119884460) has the molecular formula C20H39N3O and a molecular weight of 337.55 g/mol. Its IUPAC name is N-[2-(3-ethylpiperidin-1-yl)-2-methylpropyl]-3-piperidin-3-ylbutanamide.
| Compound Name | N-[2-(3-ethylpiperidin-1-yl)-2-methylpropyl]-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119884460 |
| Molecular Formula | C20H39N3O |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.31 |
| IUPAC Name | N-[2-(3-ethylpiperidin-1-yl)-2-methylpropyl]-3-piperidin-3-ylbutanamide |
| SMILES | CCC1CCCN(C(C)(C)CNC(=O)CC(C)C2CCCNC2)C1 |
| InChI | InChI=1S/C20H39N3O/c1-5-17-8-7-11-23(14-17)20(3,4)15-22-19(24)12-16(2)18-9-6-10-21-13-18/h16-18,21H,5-15H2,1-4H3,(H,22,24) |
| InChIKey | HTDAKOWFQZINSI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |