C17H17F4N3O2 — CID 119887683
N-[3-fluoro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-4-(methylamino)butanamide (PubChem CID 119887683) has the molecular formula C17H17F4N3O2 and a molecular weight of 371.33 g/mol. Its IUPAC name is N-[3-fluoro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-4-(methylamino)butanamide.
| Compound Name | N-[3-fluoro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119887683 |
| Molecular Formula | C17H17F4N3O2 |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[3-fluoro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)Nc1ccc(Oc2ccc(C(F)(F)F)cn2)c(F)c1 |
| InChI | InChI=1S/C17H17F4N3O2/c1-22-8-2-3-15(25)24-12-5-6-14(13(18)9-12)26-16-7-4-11(10-23-16)17(19,20)21/h4-7,9-10,22H,2-3,8H2,1H3,(H,24,25) |
| InChIKey | SEJHSLWJZVZJRO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|