C17H15F4N3O3 — CID 119887677
N-[3-fluoro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]morpholine-3-carboxamide (PubChem CID 119887677) has the molecular formula C17H15F4N3O3 and a molecular weight of 385.32 g/mol. Its IUPAC name is N-[3-fluoro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]morpholine-3-carboxamide.
| Compound Name | N-[3-fluoro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 119887677 |
| Molecular Formula | C17H15F4N3O3 |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-[3-fluoro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]morpholine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccc(C(F)(F)F)cn2)c(F)c1)C1COCCN1 |
| InChI | InChI=1S/C17H15F4N3O3/c18-12-7-11(24-16(25)13-9-26-6-5-22-13)2-3-14(12)27-15-4-1-10(8-23-15)17(19,20)21/h1-4,7-8,13,22H,5-6,9H2,(H,24,25) |
| InChIKey | QCJUSDFKBXQJGJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |