C17H27Cl2N5OS — CID 119890522
(2S)-2-amino-N-[3-(5-amino-1-phenylpyrazol-3-yl)propyl]-4-methylsulfanylbutanamide;dihydrochloride (PubChem CID 119890522) has the molecular formula C17H27Cl2N5OS and a molecular weight of 420.41 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-(5-amino-1-phenylpyrazol-3-yl)propyl]-4-methylsulfanylbutanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-N-[3-(5-amino-1-phenylpyrazol-3-yl)propyl]-4-methylsulfanylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119890522 |
| Molecular Formula | C17H27Cl2N5OS |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | (2S)-2-amino-N-[3-(5-amino-1-phenylpyrazol-3-yl)propyl]-4-methylsulfanylbutanamide;dihydrochloride |
| SMILES | CSCC[C@H](N)C(=O)NCCCc1cc(N)n(-c2ccccc2)n1.Cl.Cl |
| InChI | InChI=1S/C17H25N5OS.2ClH/c1-24-11-9-15(18)17(23)20-10-5-6-13-12-16(19)22(21-13)14-7-3-2-4-8-14;;/h2-4,7-8,12,15H,5-6,9-11,18-19H2,1H3,(H,20,23);2*1H/t15-;;/m0../s1 |
| InChIKey | KENUFUMPKLRKTN-CKUXDGONSA-N |
| XLogP | 2.43 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|