C17H25N5O — CID 119890557
N-[3-(5-amino-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-(methylamino)propanamide (PubChem CID 119890557) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is N-[3-(5-amino-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-(methylamino)propanamide.
| Compound Name | N-[3-(5-amino-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-(methylamino)propanamide |
|---|---|
| PubChem CID | 119890557 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | N-[3-(5-amino-1-phenylpyrazol-3-yl)propyl]-2-methyl-3-(methylamino)propanamide |
| SMILES | CNCC(C)C(=O)NCCCc1cc(N)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H25N5O/c1-13(12-19-2)17(23)20-10-6-7-14-11-16(18)22(21-14)15-8-4-3-5-9-15/h3-5,8-9,11,13,19H,6-7,10,12,18H2,1-2H3,(H,20,23) |
| InChIKey | QBZCMNZTQYRUIU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|