C17H27Cl2N5O2 — CID 119890576
N-[3-(5-amino-1-phenylpyrazol-3-yl)propyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride (PubChem CID 119890576) has the molecular formula C17H27Cl2N5O2 and a molecular weight of 404.34 g/mol. Its IUPAC name is N-[3-(5-amino-1-phenylpyrazol-3-yl)propyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride.
| Compound Name | N-[3-(5-amino-1-phenylpyrazol-3-yl)propyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119890576 |
| Molecular Formula | C17H27Cl2N5O2 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-[3-(5-amino-1-phenylpyrazol-3-yl)propyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride |
| SMILES | COCCNCC(=O)NCCCc1cc(N)n(-c2ccccc2)n1.Cl.Cl |
| InChI | InChI=1S/C17H25N5O2.2ClH/c1-24-11-10-19-13-17(23)20-9-5-6-14-12-16(18)22(21-14)15-7-3-2-4-8-15;;/h2-4,7-8,12,19H,5-6,9-11,13,18H2,1H3,(H,20,23);2*1H |
| InChIKey | GUSAOZCQAMGSLQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|