C16H20Cl2N4O2 — CID 119894501
3-amino-N-(3-pyridazin-3-yloxyphenyl)cyclopentane-1-carboxamide;dihydrochloride (PubChem CID 119894501) has the molecular formula C16H20Cl2N4O2 and a molecular weight of 371.27 g/mol. Its IUPAC name is 3-amino-N-(3-pyridazin-3-yloxyphenyl)cyclopentane-1-carboxamide;dihydrochloride.
| Compound Name | 3-amino-N-(3-pyridazin-3-yloxyphenyl)cyclopentane-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119894501 |
| Molecular Formula | C16H20Cl2N4O2 |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 3-amino-N-(3-pyridazin-3-yloxyphenyl)cyclopentane-1-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC1CCC(C(=O)Nc2cccc(Oc3cccnn3)c2)C1 |
| InChI | InChI=1S/C16H18N4O2.2ClH/c17-12-7-6-11(9-12)16(21)19-13-3-1-4-14(10-13)22-15-5-2-8-18-20-15;;/h1-5,8,10-12H,6-7,9,17H2,(H,19,21);2*1H |
| InChIKey | ZPOKDJVZAVCBFA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |