C20H17N3O3 — CID 124607438
(3S)-N-(3-pyridazin-3-yloxyphenyl)-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 124607438) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is (3S)-N-(3-pyridazin-3-yloxyphenyl)-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | (3S)-N-(3-pyridazin-3-yloxyphenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 124607438 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (3S)-N-(3-pyridazin-3-yloxyphenyl)-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | O=C(Nc1cccc(Oc2cccnn2)c1)[C@@H]1COc2ccccc2C1 |
| InChI | InChI=1S/C20H17N3O3/c24-20(15-11-14-5-1-2-8-18(14)25-13-15)22-16-6-3-7-17(12-16)26-19-9-4-10-21-23-19/h1-10,12,15H,11,13H2,(H,22,24)/t15-/m0/s1 |
| InChIKey | LQWPDNLGSONINE-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |