C17H22Cl2N4O3 — CID 120801133
2-amino-2-(oxan-4-yl)-N-(3-pyridazin-3-yloxyphenyl)acetamide;dihydrochloride (PubChem CID 120801133) has the molecular formula C17H22Cl2N4O3 and a molecular weight of 401.29 g/mol. Its IUPAC name is 2-amino-2-(oxan-4-yl)-N-(3-pyridazin-3-yloxyphenyl)acetamide;dihydrochloride.
| Compound Name | 2-amino-2-(oxan-4-yl)-N-(3-pyridazin-3-yloxyphenyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120801133 |
| Molecular Formula | C17H22Cl2N4O3 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-amino-2-(oxan-4-yl)-N-(3-pyridazin-3-yloxyphenyl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.NC(C(=O)Nc1cccc(Oc2cccnn2)c1)C1CCOCC1 |
| InChI | InChI=1S/C17H20N4O3.2ClH/c18-16(12-6-9-23-10-7-12)17(22)20-13-3-1-4-14(11-13)24-15-5-2-8-19-21-15;;/h1-5,8,11-12,16H,6-7,9-10,18H2,(H,20,22);2*1H |
| InChIKey | BIFMQXUWEAPSHZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |