C15H20Cl2N4O2 — CID 119894521
2-methyl-3-(methylamino)-N-(3-pyridazin-3-yloxyphenyl)propanamide;dihydrochloride (PubChem CID 119894521) has the molecular formula C15H20Cl2N4O2 and a molecular weight of 359.26 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-N-(3-pyridazin-3-yloxyphenyl)propanamide;dihydrochloride.
| Compound Name | 2-methyl-3-(methylamino)-N-(3-pyridazin-3-yloxyphenyl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119894521 |
| Molecular Formula | C15H20Cl2N4O2 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 2-methyl-3-(methylamino)-N-(3-pyridazin-3-yloxyphenyl)propanamide;dihydrochloride |
| SMILES | CNCC(C)C(=O)Nc1cccc(Oc2cccnn2)c1.Cl.Cl |
| InChI | InChI=1S/C15H18N4O2.2ClH/c1-11(10-16-2)15(20)18-12-5-3-6-13(9-12)21-14-7-4-8-17-19-14;;/h3-9,11,16H,10H2,1-2H3,(H,18,20);2*1H |
| InChIKey | SQOIGVPSNQLARU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |