C21H30N6O — CID 119900380
5-methyl-1-piperidin-4-yl-N-[1-(3-pyrrolidin-1-ylphenyl)ethyl]triazole-4-carboxamide (PubChem CID 119900380) has the molecular formula C21H30N6O and a molecular weight of 382.51 g/mol. Its IUPAC name is 5-methyl-1-piperidin-4-yl-N-[1-(3-pyrrolidin-1-ylphenyl)ethyl]triazole-4-carboxamide.
| Compound Name | 5-methyl-1-piperidin-4-yl-N-[1-(3-pyrrolidin-1-ylphenyl)ethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 119900380 |
| Molecular Formula | C21H30N6O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 5-methyl-1-piperidin-4-yl-N-[1-(3-pyrrolidin-1-ylphenyl)ethyl]triazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NC(C)c2cccc(N3CCCC3)c2)nnn1C1CCNCC1 |
| InChI | InChI=1S/C21H30N6O/c1-15(17-6-5-7-19(14-17)26-12-3-4-13-26)23-21(28)20-16(2)27(25-24-20)18-8-10-22-11-9-18/h5-7,14-15,18,22H,3-4,8-13H2,1-2H3,(H,23,28) |
| InChIKey | IBZJSEXAUBVWDA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |