C27H54O2Si3 — CID 11990191
[5,11-bis[[tert-butyl(dimethyl)silyl]oxy]-8-methylundeca-6,7-dien-1-ynyl]-trimethylsilane (PubChem CID 11990191) has the molecular formula C27H54O2Si3 and a molecular weight of 494.99 g/mol. Its IUPAC name is [5,11-bis[[tert-butyl(dimethyl)silyl]oxy]-8-methylundeca-6,7-dien-1-ynyl]-trimethylsilane.
| Compound Name | [5,11-bis[[tert-butyl(dimethyl)silyl]oxy]-8-methylundeca-6,7-dien-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 11990191 |
| Molecular Formula | C27H54O2Si3 |
| Molecular Weight | 494.99 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | [5,11-bis[[tert-butyl(dimethyl)silyl]oxy]-8-methylundeca-6,7-dien-1-ynyl]-trimethylsilane |
| SMILES | CC(=C=CC(CCC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H54O2Si3/c1-24(18-17-22-28-31(11,12)26(2,3)4)20-21-25(19-15-16-23-30(8,9)10)29-32(13,14)27(5,6)7/h21,25H,15,17-19,22H2,1-14H3 |
| InChIKey | JALCWGYGLDOVKX-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.99 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|