C23H46O2Si2 — CID 10787745
tert-butyl-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-ethenylnon-4-ynoxy]-dimethylsilane (PubChem CID 10787745) has the molecular formula C23H46O2Si2 and a molecular weight of 410.79 g/mol. Its IUPAC name is tert-butyl-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-ethenylnon-4-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-ethenylnon-4-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10787745 |
| Molecular Formula | C23H46O2Si2 |
| Molecular Weight | 410.79 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | tert-butyl-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-ethenylnon-4-ynoxy]-dimethylsilane |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CC#CCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O2Si2/c1-13-15-16-17-18-19-21(25-27(11,12)23(6,7)8)20(14-2)24-26(9,10)22(3,4)5/h14,20-21H,2,13,15-16,19H2,1,3-12H3/t20-,21-/m0/s1 |
| InChIKey | SPRDWEIZADNDQO-SFTDATJTSA-N |
| XLogP | 7.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.79 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|