C22H46O2Si3 — CID 10670142
[(4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-en-1-ynyl]-trimethylsilane (PubChem CID 10670142) has the molecular formula C22H46O2Si3 and a molecular weight of 426.87 g/mol. Its IUPAC name is [(4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-en-1-ynyl]-trimethylsilane.
| Compound Name | [(4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-en-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 10670142 |
| Molecular Formula | C22H46O2Si3 |
| Molecular Weight | 426.87 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | [(4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-en-1-ynyl]-trimethylsilane |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H46O2Si3/c1-15-19(23-26(11,12)21(2,3)4)20(17-16-18-25(8,9)10)24-27(13,14)22(5,6)7/h15,19-20H,1,17H2,2-14H3/t19-,20-/m0/s1 |
| InChIKey | TVMQUGHTQJCXCC-PMACEKPBSA-N |
| XLogP | 7.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.87 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|