C18H22N2O3 — CID 11990194
[(E)-3-(1-benzylimidazol-4-yl)prop-2-enyl] tert-butyl carbonate (PubChem CID 11990194) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is [(E)-3-(1-benzylimidazol-4-yl)prop-2-enyl] tert-butyl carbonate.
| Compound Name | [(E)-3-(1-benzylimidazol-4-yl)prop-2-enyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 11990194 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [(E)-3-(1-benzylimidazol-4-yl)prop-2-enyl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC/C=C/c1cn(Cc2ccccc2)cn1 |
| InChI | InChI=1S/C18H22N2O3/c1-18(2,3)23-17(21)22-11-7-10-16-13-20(14-19-16)12-15-8-5-4-6-9-15/h4-10,13-14H,11-12H2,1-3H3/b10-7+ |
| InChIKey | YEDWXLAUOBHLKN-JXMROGBWSA-N |
| XLogP | 3.90 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |