C18H22N2O3 — CID 175183750
2-[[1-[(4-methoxyphenyl)methyl]imidazol-4-yl]methylidene]-3,3-dimethylbutanoic acid (PubChem CID 175183750) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-[[1-[(4-methoxyphenyl)methyl]imidazol-4-yl]methylidene]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[[1-[(4-methoxyphenyl)methyl]imidazol-4-yl]methylidene]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 175183750 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-[[1-[(4-methoxyphenyl)methyl]imidazol-4-yl]methylidene]-3,3-dimethylbutanoic acid |
| SMILES | COc1ccc(Cn2cnc(C=C(C(=O)O)C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C18H22N2O3/c1-18(2,3)16(17(21)22)9-14-11-20(12-19-14)10-13-5-7-15(23-4)8-6-13/h5-9,11-12H,10H2,1-4H3,(H,21,22) |
| InChIKey | ODEVVIUINVXKID-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|