C12H11FN4O3 — CID 139773562
(E)-2-fluoro-3-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]prop-2-enoic acid (PubChem CID 139773562) has the molecular formula C12H11FN4O3 and a molecular weight of 278.24 g/mol. Its IUPAC name is (E)-2-fluoro-3-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-2-fluoro-3-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139773562 |
| Molecular Formula | C12H11FN4O3 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (E)-2-fluoro-3-[2-[(4-methoxyphenyl)methyl]tetrazol-5-yl]prop-2-enoic acid |
| SMILES | COc1ccc(Cn2nnc(/C=C(/F)C(=O)O)n2)cc1 |
| InChI | InChI=1S/C12H11FN4O3/c1-20-9-4-2-8(3-5-9)7-17-15-11(14-16-17)6-10(13)12(18)19/h2-6H,7H2,1H3,(H,18,19)/b10-6+ |
| InChIKey | ZKKNKKWZDCLPIT-UXBLZVDNSA-N |
| XLogP | 1.12 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|