C15H24ClN3O3 — CID 119906303
2-(1,4-diazepan-1-yl)-N-(2,5-dimethoxyphenyl)acetamide;hydrochloride (PubChem CID 119906303) has the molecular formula C15H24ClN3O3 and a molecular weight of 329.83 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(2,5-dimethoxyphenyl)acetamide;hydrochloride.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(2,5-dimethoxyphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119906303 |
| Molecular Formula | C15H24ClN3O3 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(2,5-dimethoxyphenyl)acetamide;hydrochloride |
| SMILES | COc1ccc(OC)c(NC(=O)CN2CCCNCC2)c1.Cl |
| InChI | InChI=1S/C15H23N3O3.ClH/c1-20-12-4-5-14(21-2)13(10-12)17-15(19)11-18-8-3-6-16-7-9-18;/h4-5,10,16H,3,6-9,11H2,1-2H3,(H,17,19);1H |
| InChIKey | DENDGPMXQBNEKJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |