C14H23Cl2N3O3 — CID 56773506
N-(2,5-dimethoxyphenyl)-2-piperazin-1-ylacetamide;dihydrochloride (PubChem CID 56773506) has the molecular formula C14H23Cl2N3O3 and a molecular weight of 352.26 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-piperazin-1-ylacetamide;dihydrochloride.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-piperazin-1-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 56773506 |
| Molecular Formula | C14H23Cl2N3O3 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-piperazin-1-ylacetamide;dihydrochloride |
| SMILES | COc1ccc(OC)c(NC(=O)CN2CCNCC2)c1.Cl.Cl |
| InChI | InChI=1S/C14H21N3O3.2ClH/c1-19-11-3-4-13(20-2)12(9-11)16-14(18)10-17-7-5-15-6-8-17;;/h3-4,9,15H,5-8,10H2,1-2H3,(H,16,18);2*1H |
| InChIKey | MOEGGMXNJBBWCY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |