C23H23N5O7 — CID 11990740
[(Z)-[[4-[3-[4-[(Z)-N'-acetyloxycarbamimidoyl]-2-methoxyphenyl]-1,2-oxazol-5-yl]-3-methoxyphenyl]-aminomethylidene]amino] acetate (PubChem CID 11990740) has the molecular formula C23H23N5O7 and a molecular weight of 481.47 g/mol. Its IUPAC name is [(Z)-[[4-[3-[4-[(Z)-N'-acetyloxycarbamimidoyl]-2-methoxyphenyl]-1,2-oxazol-5-yl]-3-methoxyphenyl]-aminomethylidene]amino] acetate.
| Compound Name | [(Z)-[[4-[3-[4-[(Z)-N'-acetyloxycarbamimidoyl]-2-methoxyphenyl]-1,2-oxazol-5-yl]-3-methoxyphenyl]-aminomethylidene]amino] acetate |
|---|---|
| PubChem CID | 11990740 |
| Molecular Formula | C23H23N5O7 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | [(Z)-[[4-[3-[4-[(Z)-N'-acetyloxycarbamimidoyl]-2-methoxyphenyl]-1,2-oxazol-5-yl]-3-methoxyphenyl]-aminomethylidene]amino] acetate |
| SMILES | COc1cc(/C(N)=N/OC(C)=O)ccc1-c1cc(-c2ccc(/C(N)=N/OC(C)=O)cc2OC)on1 |
| InChI | InChI=1S/C23H23N5O7/c1-12(29)33-27-22(24)14-5-7-16(19(9-14)31-3)18-11-21(35-26-18)17-8-6-15(10-20(17)32-4)23(25)28-34-13(2)30/h5-11H,1-4H3,(H2,24,27)(H2,25,28) |
| InChIKey | FQIQKTDFBYWXQR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 173.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|