C14H20ClN5 — CID 119917977
[1-[(2-phenyltriazol-4-yl)methyl]pyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 119917977) has the molecular formula C14H20ClN5 and a molecular weight of 293.80 g/mol. Its IUPAC name is [1-[(2-phenyltriazol-4-yl)methyl]pyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-[(2-phenyltriazol-4-yl)methyl]pyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119917977 |
| Molecular Formula | C14H20ClN5 |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | [1-[(2-phenyltriazol-4-yl)methyl]pyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCN(Cc2cnn(-c3ccccc3)n2)C1 |
| InChI | InChI=1S/C14H19N5.ClH/c15-8-12-6-7-18(10-12)11-13-9-16-19(17-13)14-4-2-1-3-5-14;/h1-5,9,12H,6-8,10-11,15H2;1H |
| InChIKey | IGOAFFDKDYWTBF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |