C18H27N5O — CID 95290386
(2R)-1-[4-[[(2-phenyltriazol-4-yl)methylamino]methyl]piperidin-1-yl]propan-2-ol (PubChem CID 95290386) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is (2R)-1-[4-[[(2-phenyltriazol-4-yl)methylamino]methyl]piperidin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[4-[[(2-phenyltriazol-4-yl)methylamino]methyl]piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 95290386 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | (2R)-1-[4-[[(2-phenyltriazol-4-yl)methylamino]methyl]piperidin-1-yl]propan-2-ol |
| SMILES | C[C@@H](O)CN1CCC(CNCc2cnn(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C18H27N5O/c1-15(24)14-22-9-7-16(8-10-22)11-19-12-17-13-20-23(21-17)18-5-3-2-4-6-18/h2-6,13,15-16,19,24H,7-12,14H2,1H3/t15-/m1/s1 |
| InChIKey | VYIZNKHFMZWALR-OAHLLOKOSA-N |
| XLogP | 1.45 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |