C19H28N4O — CID 95274104
(2S)-1-[4-[[(5-phenyl-1H-pyrazol-4-yl)methylamino]methyl]piperidin-1-yl]propan-2-ol (PubChem CID 95274104) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is (2S)-1-[4-[[(5-phenyl-1H-pyrazol-4-yl)methylamino]methyl]piperidin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[4-[[(5-phenyl-1H-pyrazol-4-yl)methylamino]methyl]piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 95274104 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | (2S)-1-[4-[[(5-phenyl-1H-pyrazol-4-yl)methylamino]methyl]piperidin-1-yl]propan-2-ol |
| SMILES | C[C@H](O)CN1CCC(CNCc2cn[nH]c2-c2ccccc2)CC1 |
| InChI | InChI=1S/C19H28N4O/c1-15(24)14-23-9-7-16(8-10-23)11-20-12-18-13-21-22-19(18)17-5-3-2-4-6-17/h2-6,13,15-16,20,24H,7-12,14H2,1H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | JGDGFMZWOBRVIQ-HNNXBMFYSA-N |
| XLogP | 2.26 |
| TPSA | 64.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |