C21H30N2O2 — CID 95335410
(2S)-1-[4-[[(4-methoxynaphthalen-1-yl)methylamino]methyl]piperidin-1-yl]propan-2-ol (PubChem CID 95335410) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is (2S)-1-[4-[[(4-methoxynaphthalen-1-yl)methylamino]methyl]piperidin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[4-[[(4-methoxynaphthalen-1-yl)methylamino]methyl]piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 95335410 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | (2S)-1-[4-[[(4-methoxynaphthalen-1-yl)methylamino]methyl]piperidin-1-yl]propan-2-ol |
| SMILES | COc1ccc(CNCC2CCN(C[C@H](C)O)CC2)c2ccccc12 |
| InChI | InChI=1S/C21H30N2O2/c1-16(24)15-23-11-9-17(10-12-23)13-22-14-18-7-8-21(25-2)20-6-4-3-5-19(18)20/h3-8,16-17,22,24H,9-15H2,1-2H3/t16-/m0/s1 |
| InChIKey | CYLBZKUWRVGLAG-INIZCTEOSA-N |
| XLogP | 3.03 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |