C18H30N2O2 — CID 95273065
(2S)-1-[4-[[(2-ethoxyphenyl)methylamino]methyl]piperidin-1-yl]propan-2-ol (PubChem CID 95273065) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is (2S)-1-[4-[[(2-ethoxyphenyl)methylamino]methyl]piperidin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[4-[[(2-ethoxyphenyl)methylamino]methyl]piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 95273065 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | (2S)-1-[4-[[(2-ethoxyphenyl)methylamino]methyl]piperidin-1-yl]propan-2-ol |
| SMILES | CCOc1ccccc1CNCC1CCN(C[C@H](C)O)CC1 |
| InChI | InChI=1S/C18H30N2O2/c1-3-22-18-7-5-4-6-17(18)13-19-12-16-8-10-20(11-9-16)14-15(2)21/h4-7,15-16,19,21H,3,8-14H2,1-2H3/t15-/m0/s1 |
| InChIKey | RFBHENJRFQYOHD-HNNXBMFYSA-N |
| XLogP | 2.27 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |