C16H20N4 — CID 60957859
1-cyclohex-3-en-1-yl-N-[(2-phenyltriazol-4-yl)methyl]methanamine (PubChem CID 60957859) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-cyclohex-3-en-1-yl-N-[(2-phenyltriazol-4-yl)methyl]methanamine.
| Compound Name | 1-cyclohex-3-en-1-yl-N-[(2-phenyltriazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 60957859 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 1-cyclohex-3-en-1-yl-N-[(2-phenyltriazol-4-yl)methyl]methanamine |
| SMILES | C1=CCC(CNCc2cnn(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C16H20N4/c1-3-7-14(8-4-1)11-17-12-15-13-18-20(19-15)16-9-5-2-6-10-16/h1-3,5-6,9-10,13-14,17H,4,7-8,11-12H2 |
| InChIKey | UVUQEWBBEURUIQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|