C19H29ClN4O — CID 119919779
1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-[3-(methylamino)piperidin-1-yl]ethanone (PubChem CID 119919779) has the molecular formula C19H29ClN4O and a molecular weight of 364.92 g/mol. Its IUPAC name is 1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-[3-(methylamino)piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-[3-(methylamino)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 119919779 |
| Molecular Formula | C19H29ClN4O |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-2-[3-(methylamino)piperidin-1-yl]ethanone |
| SMILES | CNC1CCCN(CC(=O)N2CCN(Cc3cccc(Cl)c3)CC2)C1 |
| InChI | InChI=1S/C19H29ClN4O/c1-21-18-6-3-7-23(14-18)15-19(25)24-10-8-22(9-11-24)13-16-4-2-5-17(20)12-16/h2,4-5,12,18,21H,3,6-11,13-15H2,1H3 |
| InChIKey | JGZZYLCZXPDQOW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |