About 2-bromoaniline
2-bromoaniline (PubChem CID 11992) has the molecular formula C6H6BrN
and a molecular weight of 172.03 g/mol. Its IUPAC name is 2-bromoaniline.
Molecular Properties
| Compound Name | 2-bromoaniline |
| PubChem CID | 11992 |
| Molecular Formula | C6H6BrN |
| Molecular Weight | 172.03 g/mol |
| Exact Mass | 170.97 |
| IUPAC Name | 2-bromoaniline |
| SMILES | Nc1ccccc1Br |
| InChI | InChI=1S/C6H6BrN/c7-5-3-1-2-4-6(5)8/h1-4H,8H2 |
| InChIKey | AOPBDRUWRLBSDB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.03 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoaniline?
The IUPAC name of 2-bromoaniline (CID 11992) is 2-bromoaniline.
What is the SMILES notation for 2-bromoaniline?
The canonical SMILES for 2-bromoaniline is Nc1ccccc1Br.
What is the InChIKey of 2-bromoaniline?
The InChIKey is AOPBDRUWRLBSDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrN/c7-5-3-1-2-4-6(5)8/h1-4H,8H2.
What are the key properties of 2-bromoaniline?
2-bromoaniline has a molecular weight of 172.03 g/mol, XLogP of 2.03, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoaniline is sourced from PubChem (CID 11992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).