C6H4Br3N — CID 8986
2,4,6-tribromoaniline (PubChem CID 8986) has the molecular formula C6H4Br3N and a molecular weight of 329.82 g/mol. Its IUPAC name is 2,4,6-tribromoaniline.
| Compound Name | 2,4,6-tribromoaniline |
|---|---|
| PubChem CID | 8986 |
| Molecular Formula | C6H4Br3N |
| Molecular Weight | 329.82 g/mol |
| Exact Mass | 326.79 |
| IUPAC Name | 2,4,6-tribromoaniline |
| SMILES | Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C6H4Br3N/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
| InChIKey | GVPODVKBTHCGFU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.82 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|