About 4-bromo-2,6-difluoroaniline
4-bromo-2,6-difluoroaniline (PubChem CID 610191) has the molecular formula C6H4BrF2N
and a molecular weight of 208.00 g/mol. Its IUPAC name is 4-bromo-2,6-difluoroaniline.
Molecular Properties
| Compound Name | 4-bromo-2,6-difluoroaniline |
| PubChem CID | 610191 |
| Molecular Formula | C6H4BrF2N |
| Molecular Weight | 208.00 g/mol |
| Exact Mass | 206.95 |
| IUPAC Name | 4-bromo-2,6-difluoroaniline |
| SMILES | Nc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C6H4BrF2N/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
| InChIKey | BFQSQUAVMNHOEF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.00 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2,6-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,6-difluoroaniline?
The IUPAC name of 4-bromo-2,6-difluoroaniline (CID 610191) is 4-bromo-2,6-difluoroaniline.
What is the SMILES notation for 4-bromo-2,6-difluoroaniline?
The canonical SMILES for 4-bromo-2,6-difluoroaniline is Nc1c(F)cc(Br)cc1F.
What is the InChIKey of 4-bromo-2,6-difluoroaniline?
The InChIKey is BFQSQUAVMNHOEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrF2N/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2.
What are the key properties of 4-bromo-2,6-difluoroaniline?
4-bromo-2,6-difluoroaniline has a molecular weight of 208.00 g/mol, XLogP of 2.31, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,6-difluoroaniline is sourced from PubChem (CID 610191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).