C11H13NO2S — CID 11992672
4-benzyl-3-methylsulfanyl-1,3-oxazolidin-2-one (PubChem CID 11992672) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 4-benzyl-3-methylsulfanyl-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-methylsulfanyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11992672 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 4-benzyl-3-methylsulfanyl-1,3-oxazolidin-2-one |
| SMILES | CSN1C(=O)OCC1Cc1ccccc1 |
| InChI | InChI=1S/C11H13NO2S/c1-15-12-10(8-14-11(12)13)7-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3 |
| InChIKey | GUALRTTUMRBKTG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|