C11H22Cl2N4 — CID 119928529
N-methyl-1-[1-(2-pyrazol-1-ylethyl)pyrrolidin-2-yl]methanamine;dihydrochloride (PubChem CID 119928529) has the molecular formula C11H22Cl2N4 and a molecular weight of 281.23 g/mol. Its IUPAC name is N-methyl-1-[1-(2-pyrazol-1-ylethyl)pyrrolidin-2-yl]methanamine;dihydrochloride.
| Compound Name | N-methyl-1-[1-(2-pyrazol-1-ylethyl)pyrrolidin-2-yl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 119928529 |
| Molecular Formula | C11H22Cl2N4 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-methyl-1-[1-(2-pyrazol-1-ylethyl)pyrrolidin-2-yl]methanamine;dihydrochloride |
| SMILES | CNCC1CCCN1CCn1cccn1.Cl.Cl |
| InChI | InChI=1S/C11H20N4.2ClH/c1-12-10-11-4-2-6-14(11)8-9-15-7-3-5-13-15;;/h3,5,7,11-12H,2,4,6,8-10H2,1H3;2*1H |
| InChIKey | CNRKOQNBWVGXEA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |