C15H25ClN2S — CID 120842714
1-[1-(2-benzylsulfanylethyl)pyrrolidin-2-yl]-N-methylmethanamine;hydrochloride (PubChem CID 120842714) has the molecular formula C15H25ClN2S and a molecular weight of 300.90 g/mol. Its IUPAC name is 1-[1-(2-benzylsulfanylethyl)pyrrolidin-2-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[1-(2-benzylsulfanylethyl)pyrrolidin-2-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 120842714 |
| Molecular Formula | C15H25ClN2S |
| Molecular Weight | 300.90 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-[1-(2-benzylsulfanylethyl)pyrrolidin-2-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCC1CCCN1CCSCc1ccccc1.Cl |
| InChI | InChI=1S/C15H24N2S.ClH/c1-16-12-15-8-5-9-17(15)10-11-18-13-14-6-3-2-4-7-14;/h2-4,6-7,15-16H,5,8-13H2,1H3;1H |
| InChIKey | RREPTDHIWMQASF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.90 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|