C17H25ClFN3O — CID 119930083
(3-fluorophenyl)-[4-(piperidin-3-ylmethyl)piperazin-1-yl]methanone;hydrochloride (PubChem CID 119930083) has the molecular formula C17H25ClFN3O and a molecular weight of 341.86 g/mol. Its IUPAC name is (3-fluorophenyl)-[4-(piperidin-3-ylmethyl)piperazin-1-yl]methanone;hydrochloride.
| Compound Name | (3-fluorophenyl)-[4-(piperidin-3-ylmethyl)piperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119930083 |
| Molecular Formula | C17H25ClFN3O |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (3-fluorophenyl)-[4-(piperidin-3-ylmethyl)piperazin-1-yl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1cccc(F)c1)N1CCN(CC2CCCNC2)CC1 |
| InChI | InChI=1S/C17H24FN3O.ClH/c18-16-5-1-4-15(11-16)17(22)21-9-7-20(8-10-21)13-14-3-2-6-19-12-14;/h1,4-5,11,14,19H,2-3,6-10,12-13H2;1H |
| InChIKey | JGONUFPASDWLIX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |