C18H27ClN2O — CID 119931655
2-(2-chlorophenyl)-5,5-dimethyl-4-(piperidin-3-ylmethyl)morpholine (PubChem CID 119931655) has the molecular formula C18H27ClN2O and a molecular weight of 322.88 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-5,5-dimethyl-4-(piperidin-3-ylmethyl)morpholine.
| Compound Name | 2-(2-chlorophenyl)-5,5-dimethyl-4-(piperidin-3-ylmethyl)morpholine |
|---|---|
| PubChem CID | 119931655 |
| Molecular Formula | C18H27ClN2O |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-(2-chlorophenyl)-5,5-dimethyl-4-(piperidin-3-ylmethyl)morpholine |
| SMILES | CC1(C)COC(c2ccccc2Cl)CN1CC1CCCNC1 |
| InChI | InChI=1S/C18H27ClN2O/c1-18(2)13-22-17(15-7-3-4-8-16(15)19)12-21(18)11-14-6-5-9-20-10-14/h3-4,7-8,14,17,20H,5-6,9-13H2,1-2H3 |
| InChIKey | PRELKJGZNURRAS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |