About N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-thiomorpholin-3-ylacetamide
N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-thiomorpholin-3-ylacetamide (PubChem CID 119938369) has the molecular formula C14H17N3O3S
and a molecular weight of 307.38 g/mol. Its IUPAC name is N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-thiomorpholin-3-ylacetamide.
Molecular Properties
| Compound Name | N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-thiomorpholin-3-ylacetamide |
| PubChem CID | 119938369 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-thiomorpholin-3-ylacetamide |
| SMILES | Cn1c(=O)oc2cc(NC(=O)CC3CSCCN3)ccc21 |
| InChI | InChI=1S/C14H17N3O3S/c1-17-11-3-2-9(6-12(11)20-14(17)19)16-13(18)7-10-8-21-5-4-15-10/h2-3,6,10,15H,4-5,7-8H2,1H3,(H,16,18) |
| InChIKey | KSOREEKZDNIDPQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-thiomorpholin-3-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-thiomorpholin-3-ylacetamide?
The IUPAC name of N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-thiomorpholin-3-ylacetamide (CID 119938369) is N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-thiomorpholin-3-ylacetamide.
What is the SMILES notation for N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-thiomorpholin-3-ylacetamide?
The canonical SMILES for N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-thiomorpholin-3-ylacetamide is Cn1c(=O)oc2cc(NC(=O)CC3CSCCN3)ccc21.
What is the InChIKey of N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-thiomorpholin-3-ylacetamide?
The InChIKey is KSOREEKZDNIDPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3S/c1-17-11-3-2-9(6-12(11)20-14(17)19)16-13(18)7-10-8-21-5-4-15-10/h2-3,6,10,15H,4-5,7-8H2,1H3,(H,16,18).
What are the key properties of N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-thiomorpholin-3-ylacetamide?
N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-thiomorpholin-3-ylacetamide has a molecular weight of 307.38 g/mol, XLogP of 1.17, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-thiomorpholin-3-ylacetamide is sourced from PubChem (CID 119938369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).