C14H21ClN2O2S2 — CID 119940145
2-thiomorpholin-3-yl-1-(2-thiophen-3-ylmorpholin-4-yl)ethanone;hydrochloride (PubChem CID 119940145) has the molecular formula C14H21ClN2O2S2 and a molecular weight of 348.92 g/mol. Its IUPAC name is 2-thiomorpholin-3-yl-1-(2-thiophen-3-ylmorpholin-4-yl)ethanone;hydrochloride.
| Compound Name | 2-thiomorpholin-3-yl-1-(2-thiophen-3-ylmorpholin-4-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119940145 |
| Molecular Formula | C14H21ClN2O2S2 |
| Molecular Weight | 348.92 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2-thiomorpholin-3-yl-1-(2-thiophen-3-ylmorpholin-4-yl)ethanone;hydrochloride |
| SMILES | Cl.O=C(CC1CSCCN1)N1CCOC(c2ccsc2)C1 |
| InChI | InChI=1S/C14H20N2O2S2.ClH/c17-14(7-12-10-20-6-2-15-12)16-3-4-18-13(8-16)11-1-5-19-9-11;/h1,5,9,12-13,15H,2-4,6-8,10H2;1H |
| InChIKey | PURJLPNTDVZYQB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.92 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |