C17H23IN4O3S2 — CID 119942654
1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-[(5-methylthiophen-2-yl)sulfonylamino]ethyl]guanidine;hydroiodide (PubChem CID 119942654) has the molecular formula C17H23IN4O3S2 and a molecular weight of 522.43 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-[(5-methylthiophen-2-yl)sulfonylamino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-[(5-methylthiophen-2-yl)sulfonylamino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119942654 |
| Molecular Formula | C17H23IN4O3S2 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 522.03 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-[(5-methylthiophen-2-yl)sulfonylamino]ethyl]guanidine;hydroiodide |
| SMILES | Cc1ccc(S(=O)(=O)NCC/N=C(\N)NC2CCOc3ccccc32)s1.I |
| InChI | InChI=1S/C17H22N4O3S2.HI/c1-12-6-7-16(25-12)26(22,23)20-10-9-19-17(18)21-14-8-11-24-15-5-3-2-4-13(14)15;/h2-7,14,20H,8-11H2,1H3,(H3,18,19,21);1H |
| InChIKey | WJOHZVLJXAVDKY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|