C20H26Cl2N4O2 — CID 119946370
2-[4-(2-aminobenzoyl)piperazin-1-yl]-N-benzylacetamide;dihydrochloride (PubChem CID 119946370) has the molecular formula C20H26Cl2N4O2 and a molecular weight of 425.36 g/mol. Its IUPAC name is 2-[4-(2-aminobenzoyl)piperazin-1-yl]-N-benzylacetamide;dihydrochloride.
| Compound Name | 2-[4-(2-aminobenzoyl)piperazin-1-yl]-N-benzylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119946370 |
| Molecular Formula | C20H26Cl2N4O2 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2-[4-(2-aminobenzoyl)piperazin-1-yl]-N-benzylacetamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1C(=O)N1CCN(CC(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N4O2.2ClH/c21-18-9-5-4-8-17(18)20(26)24-12-10-23(11-13-24)15-19(25)22-14-16-6-2-1-3-7-16;;/h1-9H,10-15,21H2,(H,22,25);2*1H |
| InChIKey | NGQVWKAOFUHOLC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|