C20H23F3N2O3 — CID 119950359
3-amino-N-[2-hydroxy-3-[2-(trifluoromethyl)phenoxy]propyl]-N-methyl-3-phenylpropanamide (PubChem CID 119950359) has the molecular formula C20H23F3N2O3 and a molecular weight of 396.41 g/mol. Its IUPAC name is 3-amino-N-[2-hydroxy-3-[2-(trifluoromethyl)phenoxy]propyl]-N-methyl-3-phenylpropanamide.
| Compound Name | 3-amino-N-[2-hydroxy-3-[2-(trifluoromethyl)phenoxy]propyl]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 119950359 |
| Molecular Formula | C20H23F3N2O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 3-amino-N-[2-hydroxy-3-[2-(trifluoromethyl)phenoxy]propyl]-N-methyl-3-phenylpropanamide |
| SMILES | CN(CC(O)COc1ccccc1C(F)(F)F)C(=O)CC(N)c1ccccc1 |
| InChI | InChI=1S/C20H23F3N2O3/c1-25(19(27)11-17(24)14-7-3-2-4-8-14)12-15(26)13-28-18-10-6-5-9-16(18)20(21,22)23/h2-10,15,17,26H,11-13,24H2,1H3 |
| InChIKey | HQPPYTFXAZEFAG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |