C18H25F3N2O3 — CID 52502216
3-cyclohexyl-1-[(2S)-2-hydroxy-3-[2-(trifluoromethyl)phenoxy]propyl]-1-methylurea (PubChem CID 52502216) has the molecular formula C18H25F3N2O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(2S)-2-hydroxy-3-[2-(trifluoromethyl)phenoxy]propyl]-1-methylurea.
| Compound Name | 3-cyclohexyl-1-[(2S)-2-hydroxy-3-[2-(trifluoromethyl)phenoxy]propyl]-1-methylurea |
|---|---|
| PubChem CID | 52502216 |
| Molecular Formula | C18H25F3N2O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 3-cyclohexyl-1-[(2S)-2-hydroxy-3-[2-(trifluoromethyl)phenoxy]propyl]-1-methylurea |
| SMILES | CN(C[C@H](O)COc1ccccc1C(F)(F)F)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H25F3N2O3/c1-23(17(25)22-13-7-3-2-4-8-13)11-14(24)12-26-16-10-6-5-9-15(16)18(19,20)21/h5-6,9-10,13-14,24H,2-4,7-8,11-12H2,1H3,(H,22,25)/t14-/m0/s1 |
| InChIKey | WCTANEMYKLOUGD-AWEZNQCLSA-N |
| XLogP | 3.42 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |