C15H21N3O4S — CID 119968157
N-(8-azabicyclo[3.2.1]octan-3-yl)-2,3-dimethyl-6-nitrobenzenesulfonamide (PubChem CID 119968157) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-2,3-dimethyl-6-nitrobenzenesulfonamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2,3-dimethyl-6-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 119968157 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2,3-dimethyl-6-nitrobenzenesulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])c(S(=O)(=O)NC2CC3CCC(C2)N3)c1C |
| InChI | InChI=1S/C15H21N3O4S/c1-9-3-6-14(18(19)20)15(10(9)2)23(21,22)17-13-7-11-4-5-12(8-13)16-11/h3,6,11-13,16-17H,4-5,7-8H2,1-2H3 |
| InChIKey | YBGIPEQFBZBGAW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|